C17H18F3N3O2S — CID 51112589
3-methyl-4-oxo-2-sulfanylidene-N-[2-(trifluoromethyl)cyclohexyl]-1H-quinazoline-7-carboxamide (PubChem CID 51112589) has the molecular formula C17H18F3N3O2S and a molecular weight of 385.41 g/mol. Its IUPAC name is 3-methyl-4-oxo-2-sulfanylidene-N-[2-(trifluoromethyl)cyclohexyl]-1H-quinazoline-7-carboxamide.
| Compound Name | 3-methyl-4-oxo-2-sulfanylidene-N-[2-(trifluoromethyl)cyclohexyl]-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 51112589 |
| Molecular Formula | C17H18F3N3O2S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-methyl-4-oxo-2-sulfanylidene-N-[2-(trifluoromethyl)cyclohexyl]-1H-quinazoline-7-carboxamide |
| SMILES | Cn1c(=S)[nH]c2cc(C(=O)NC3CCCCC3C(F)(F)F)ccc2c1=O |
| InChI | InChI=1S/C17H18F3N3O2S/c1-23-15(25)10-7-6-9(8-13(10)22-16(23)26)14(24)21-12-5-3-2-4-11(12)17(18,19)20/h6-8,11-12H,2-5H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | CYXUEIIIUCEKFZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|