C18H20F3N3O2S — CID 35247625
3-ethyl-4-oxo-2-sulfanylidene-N-[(1R,2S)-2-(trifluoromethyl)cyclohexyl]-1H-quinazoline-7-carboxamide (PubChem CID 35247625) has the molecular formula C18H20F3N3O2S and a molecular weight of 399.44 g/mol. Its IUPAC name is 3-ethyl-4-oxo-2-sulfanylidene-N-[(1R,2S)-2-(trifluoromethyl)cyclohexyl]-1H-quinazoline-7-carboxamide.
| Compound Name | 3-ethyl-4-oxo-2-sulfanylidene-N-[(1R,2S)-2-(trifluoromethyl)cyclohexyl]-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 35247625 |
| Molecular Formula | C18H20F3N3O2S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 3-ethyl-4-oxo-2-sulfanylidene-N-[(1R,2S)-2-(trifluoromethyl)cyclohexyl]-1H-quinazoline-7-carboxamide |
| SMILES | CCn1c(=S)[nH]c2cc(C(=O)N[C@@H]3CCCC[C@@H]3C(F)(F)F)ccc2c1=O |
| InChI | InChI=1S/C18H20F3N3O2S/c1-2-24-16(26)11-8-7-10(9-14(11)23-17(24)27)15(25)22-13-6-4-3-5-12(13)18(19,20)21/h7-9,12-13H,2-6H2,1H3,(H,22,25)(H,23,27)/t12-,13+/m0/s1 |
| InChIKey | DYQLTDZMIDBUKP-QWHCGFSZSA-N |
| XLogP | 3.93 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|