C22H32N4O2S — CID 92694759
3-[2-(diethylamino)ethyl]-N-[(1S,2R)-2-methylcyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 92694759) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethyl]-N-[(1S,2R)-2-methylcyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-[2-(diethylamino)ethyl]-N-[(1S,2R)-2-methylcyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 92694759 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 3-[2-(diethylamino)ethyl]-N-[(1S,2R)-2-methylcyclohexyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | CCN(CC)CCn1c(=S)[nH]c2cc(C(=O)N[C@H]3CCCC[C@H]3C)ccc2c1=O |
| InChI | InChI=1S/C22H32N4O2S/c1-4-25(5-2)12-13-26-21(28)17-11-10-16(14-19(17)24-22(26)29)20(27)23-18-9-7-6-8-15(18)3/h10-11,14-15,18H,4-9,12-13H2,1-3H3,(H,23,27)(H,24,29)/t15-,18+/m1/s1 |
| InChIKey | QTEVQTLGDJPJJS-QAPCUYQASA-N |
| XLogP | 3.71 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|