C18H23N3O3 — CID 40842866
1-ethyl-N-[(1R,2S)-2-methylcyclohexyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 40842866) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-ethyl-N-[(1R,2S)-2-methylcyclohexyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-N-[(1R,2S)-2-methylcyclohexyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 40842866 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-ethyl-N-[(1R,2S)-2-methylcyclohexyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)N[C@@H]3CCCC[C@@H]3C)ccc21 |
| InChI | InChI=1S/C18H23N3O3/c1-3-21-15-9-8-12(10-14(15)20-17(23)18(21)24)16(22)19-13-7-5-4-6-11(13)2/h8-11,13H,3-7H2,1-2H3,(H,19,22)(H,20,23)/t11-,13+/m0/s1 |
| InChIKey | IOUOYZNZPFUIIN-WCQYABFASA-N |
| XLogP | 2.02 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|