C17H16N4O3S — CID 32864496
N-(4-cyclopropyl-1,3-thiazol-2-yl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 32864496) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 32864496 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)Nc3nc(C4CC4)cs3)ccc21 |
| InChI | InChI=1S/C17H16N4O3S/c1-2-21-13-6-5-10(7-11(13)18-15(23)16(21)24)14(22)20-17-19-12(8-25-17)9-3-4-9/h5-9H,2-4H2,1H3,(H,18,23)(H,19,20,22) |
| InChIKey | ORKYIWLYCWRHIG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|