C21H19N5O5S2 — CID 24568371
1-ethyl-N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 24568371) has the molecular formula C21H19N5O5S2 and a molecular weight of 485.55 g/mol. Its IUPAC name is 1-ethyl-N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 24568371 |
| Molecular Formula | C21H19N5O5S2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 1-ethyl-N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)Nc3nc(-c4ccc(NS(C)(=O)=O)cc4)cs3)ccc21 |
| InChI | InChI=1S/C21H19N5O5S2/c1-3-26-17-9-6-13(10-15(17)22-19(28)20(26)29)18(27)24-21-23-16(11-32-21)12-4-7-14(8-5-12)25-33(2,30)31/h4-11,25H,3H2,1-2H3,(H,22,28)(H,23,24,27) |
| InChIKey | WTIXIVANMYMGCE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|