C19H15N5O5S2 — CID 55821823
N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]-7-nitro-1H-indole-2-carboxamide (PubChem CID 55821823) has the molecular formula C19H15N5O5S2 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]-7-nitro-1H-indole-2-carboxamide.
| Compound Name | N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]-7-nitro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55821823 |
| Molecular Formula | C19H15N5O5S2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | N-[4-[4-(methanesulfonamido)phenyl]-1,3-thiazol-2-yl]-7-nitro-1H-indole-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2csc(NC(=O)c3cc4cccc([N+](=O)[O-])c4[nH]3)n2)cc1 |
| InChI | InChI=1S/C19H15N5O5S2/c1-31(28,29)23-13-7-5-11(6-8-13)15-10-30-19(21-15)22-18(25)14-9-12-3-2-4-16(24(26)27)17(12)20-14/h2-10,20,23H,1H3,(H,21,22,25) |
| InChIKey | PRJJLFYDAOWWFI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 147.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|