C19H16N4O4S — CID 24564378
1-ethyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 24564378) has the molecular formula C19H16N4O4S and a molecular weight of 396.43 g/mol. Its IUPAC name is 1-ethyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 24564378 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-ethyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)Nc3nc4ccc(OC)cc4s3)ccc21 |
| InChI | InChI=1S/C19H16N4O4S/c1-3-23-14-7-4-10(8-13(14)20-17(25)18(23)26)16(24)22-19-21-12-6-5-11(27-2)9-15(12)28-19/h4-9H,3H2,1-2H3,(H,20,25)(H,21,22,24) |
| InChIKey | SFJHCFFJCVMYCV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|