C19H18ClN3O5 — CID 26620345
N-(4-chloro-2,5-dimethoxyphenyl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 26620345) has the molecular formula C19H18ClN3O5 and a molecular weight of 403.82 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 26620345 |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)Nc3cc(OC)c(Cl)cc3OC)ccc21 |
| InChI | InChI=1S/C19H18ClN3O5/c1-4-23-14-6-5-10(7-12(14)21-18(25)19(23)26)17(24)22-13-9-15(27-2)11(20)8-16(13)28-3/h5-9H,4H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | CCPUNQXLUIZDKF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|