C25H20N4O4 — CID 60578176
N-[4-(4-cyanophenoxy)-2-methylphenyl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 60578176) has the molecular formula C25H20N4O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is N-[4-(4-cyanophenoxy)-2-methylphenyl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | N-[4-(4-cyanophenoxy)-2-methylphenyl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 60578176 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[4-(4-cyanophenoxy)-2-methylphenyl]-1-ethyl-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)Nc3ccc(Oc4ccc(C#N)cc4)cc3C)ccc21 |
| InChI | InChI=1S/C25H20N4O4/c1-3-29-22-11-6-17(13-21(22)28-24(31)25(29)32)23(30)27-20-10-9-19(12-15(20)2)33-18-7-4-16(14-26)5-8-18/h4-13H,3H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | FJWSIPMLPYBPFD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|