C25H20N4O2 — CID 60578238
N-[4-(4-cyanophenoxy)-2-methylphenyl]-5-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 60578238) has the molecular formula C25H20N4O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[4-(4-cyanophenoxy)-2-methylphenyl]-5-methyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[4-(4-cyanophenoxy)-2-methylphenyl]-5-methyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60578238 |
| Molecular Formula | C25H20N4O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[4-(4-cyanophenoxy)-2-methylphenyl]-5-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1cc(Oc2ccc(C#N)cc2)ccc1NC(=O)c1cnn(-c2ccccc2)c1C |
| InChI | InChI=1S/C25H20N4O2/c1-17-14-22(31-21-10-8-19(15-26)9-11-21)12-13-24(17)28-25(30)23-16-27-29(18(23)2)20-6-4-3-5-7-20/h3-14,16H,1-2H3,(H,28,30) |
| InChIKey | YXIKIKGZWNNCMY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |