C20H17N5O3 — CID 25395657
N'-[2-(4-cyanophenoxy)acetyl]-5-methyl-1-phenylpyrazole-4-carbohydrazide (PubChem CID 25395657) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is N'-[2-(4-cyanophenoxy)acetyl]-5-methyl-1-phenylpyrazole-4-carbohydrazide.
| Compound Name | N'-[2-(4-cyanophenoxy)acetyl]-5-methyl-1-phenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 25395657 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N'-[2-(4-cyanophenoxy)acetyl]-5-methyl-1-phenylpyrazole-4-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)COc2ccc(C#N)cc2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C20H17N5O3/c1-14-18(12-22-25(14)16-5-3-2-4-6-16)20(27)24-23-19(26)13-28-17-9-7-15(11-21)8-10-17/h2-10,12H,13H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | VXIXUCHZBRBGIT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|