C15H14N2O4 — CID 4736888
methyl 4-(5-methyl-1-phenylpyrazol-4-yl)-2,4-dioxobutanoate (PubChem CID 4736888) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is methyl 4-(5-methyl-1-phenylpyrazol-4-yl)-2,4-dioxobutanoate.
| Compound Name | methyl 4-(5-methyl-1-phenylpyrazol-4-yl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 4736888 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | methyl 4-(5-methyl-1-phenylpyrazol-4-yl)-2,4-dioxobutanoate |
| SMILES | COC(=O)C(=O)CC(=O)c1cnn(-c2ccccc2)c1C |
| InChI | InChI=1S/C15H14N2O4/c1-10-12(13(18)8-14(19)15(20)21-2)9-16-17(10)11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | OPUNFUITYWSQTF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|