C27H24N4O2 — CID 178184437
1,7-bis(5-methyl-1-phenylpyrazol-4-yl)hepta-1,6-diene-3,5-dione (PubChem CID 178184437) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 1,7-bis(5-methyl-1-phenylpyrazol-4-yl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1,7-bis(5-methyl-1-phenylpyrazol-4-yl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 178184437 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1,7-bis(5-methyl-1-phenylpyrazol-4-yl)hepta-1,6-diene-3,5-dione |
| SMILES | Cc1c(C=CC(=O)CC(=O)C=Cc2cnn(-c3ccccc3)c2C)cnn1-c1ccccc1 |
| InChI | InChI=1S/C27H24N4O2/c1-20-22(18-28-30(20)24-9-5-3-6-10-24)13-15-26(32)17-27(33)16-14-23-19-29-31(21(23)2)25-11-7-4-8-12-25/h3-16,18-19H,17H2,1-2H3 |
| InChIKey | WYVSKBZXCDVJPF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|