C21H22N4O5 — CID 30859500
1-ethyl-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide (PubChem CID 30859500) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 1-ethyl-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 30859500 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-ethyl-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-2,3-dioxo-4H-quinoxaline-6-carboxamide |
| SMILES | CCNC(=O)COc1ccc(NC(=O)c2ccc3c(c2)[nH]c(=O)c(=O)n3CC)cc1 |
| InChI | InChI=1S/C21H22N4O5/c1-3-22-18(26)12-30-15-8-6-14(7-9-15)23-19(27)13-5-10-17-16(11-13)24-20(28)21(29)25(17)4-2/h5-11H,3-4,12H2,1-2H3,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | JVEHHYHEKLSFRM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|