C18H17N3O3S — CID 98287911
3-methyl-4-oxo-2-sulfanylidene-N-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]-1H-quinazoline-7-carboxamide (PubChem CID 98287911) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-methyl-4-oxo-2-sulfanylidene-N-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]-1H-quinazoline-7-carboxamide.
| Compound Name | 3-methyl-4-oxo-2-sulfanylidene-N-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 98287911 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-methyl-4-oxo-2-sulfanylidene-N-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]-1H-quinazoline-7-carboxamide |
| SMILES | Cn1c(=S)[nH]c2cc(C(=O)N[C@H]3CCCc4occc43)ccc2c1=O |
| InChI | InChI=1S/C18H17N3O3S/c1-21-17(23)12-6-5-10(9-14(12)20-18(21)25)16(22)19-13-3-2-4-15-11(13)7-8-24-15/h5-9,13H,2-4H2,1H3,(H,19,22)(H,20,25)/t13-/m0/s1 |
| InChIKey | HYBFHQHFTIKTNB-ZDUSSCGKSA-N |
| XLogP | 3.00 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|