C20H21N5O2S — CID 25348676
N-[(4S)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 25348676) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is N-[(4S)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[(4S)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 25348676 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[(4S)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)N[C@H]3CCCc4c3cnn4C)ccc2c1=O |
| InChI | InChI=1S/C20H21N5O2S/c1-3-9-25-19(27)13-8-7-12(10-16(13)23-20(25)28)18(26)22-15-5-4-6-17-14(15)11-21-24(17)2/h3,7-8,10-11,15H,1,4-6,9H2,2H3,(H,22,26)(H,23,28)/t15-/m0/s1 |
| InChIKey | ONZHZOQKZAZYKM-HNNXBMFYSA-N |
| XLogP | 2.79 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|