C21H18FN3O2S2 — CID 42921934
N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 42921934) has the molecular formula C21H18FN3O2S2 and a molecular weight of 427.53 g/mol. Its IUPAC name is N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 42921934 |
| Molecular Formula | C21H18FN3O2S2 |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-(8-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)NC3CCSc4c(F)cccc43)ccc2c1=O |
| InChI | InChI=1S/C21H18FN3O2S2/c1-2-9-25-20(27)14-7-6-12(11-17(14)24-21(25)28)19(26)23-16-8-10-29-18-13(16)4-3-5-15(18)22/h2-7,11,16H,1,8-10H2,(H,23,26)(H,24,28) |
| InChIKey | GERXUXSXASUJBD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|