C13H14N2O5 — CID 99833611
3-hydroxy-4-nitro-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]benzamide (PubChem CID 99833611) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 3-hydroxy-4-nitro-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]benzamide.
| Compound Name | 3-hydroxy-4-nitro-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]benzamide |
|---|---|
| PubChem CID | 99833611 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-hydroxy-4-nitro-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]benzamide |
| SMILES | O=C(N[C@H]1C[C@H]2CC[C@H]1O2)c1ccc([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C13H14N2O5/c16-11-5-7(1-3-10(11)15(18)19)13(17)14-9-6-8-2-4-12(9)20-8/h1,3,5,8-9,12,16H,2,4,6H2,(H,14,17)/t8-,9+,12-/m1/s1 |
| InChIKey | FZNSNTCNOVLVPY-VDDIYKPWSA-N |
| XLogP | 1.35 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|