C13H13FN2O4 — CID 80611768
3-fluoro-4-nitro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide (PubChem CID 80611768) has the molecular formula C13H13FN2O4 and a molecular weight of 280.25 g/mol. Its IUPAC name is 3-fluoro-4-nitro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide.
| Compound Name | 3-fluoro-4-nitro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide |
|---|---|
| PubChem CID | 80611768 |
| Molecular Formula | C13H13FN2O4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-fluoro-4-nitro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide |
| SMILES | O=C(NC1CC2CCC1O2)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C13H13FN2O4/c14-9-5-7(1-3-11(9)16(18)19)13(17)15-10-6-8-2-4-12(10)20-8/h1,3,5,8,10,12H,2,4,6H2,(H,15,17) |
| InChIKey | IKYAQDGHEPVQAO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|