C13H15FN2O4 — CID 104957120
3-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-4-nitrobenzamide (PubChem CID 104957120) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 3-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-4-nitrobenzamide.
| Compound Name | 3-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 104957120 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-fluoro-N-[(1S,2S)-2-hydroxycyclohexyl]-4-nitrobenzamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C13H15FN2O4/c14-9-7-8(5-6-11(9)16(19)20)13(18)15-10-3-1-2-4-12(10)17/h5-7,10,12,17H,1-4H2,(H,15,18)/t10-,12-/m0/s1 |
| InChIKey | OEUZXOMYBHAACJ-JQWIXIFHSA-N |
| XLogP | 1.77 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|