C16H18N2O3S — CID 100908067
N-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide (PubChem CID 100908067) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 100908067 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
| SMILES | CC1(C)[C@H](NC(=O)c2ccc3[nH]c(=S)oc3c2)[C@@H]2CCO[C@H]21 |
| InChI | InChI=1S/C16H18N2O3S/c1-16(2)12(9-5-6-20-13(9)16)18-14(19)8-3-4-10-11(7-8)21-15(22)17-10/h3-4,7,9,12-13H,5-6H2,1-2H3,(H,17,22)(H,18,19)/t9-,12+,13+/m0/s1 |
| InChIKey | GSSUGLUMUQSOSM-ZWKOPEQDSA-N |
| XLogP | 3.03 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|