C16H21N5O2S — CID 97054229
1-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-[3-[(R)-methylsulfinyl]phenyl]urea (PubChem CID 97054229) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-[3-[(R)-methylsulfinyl]phenyl]urea.
| Compound Name | 1-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-[3-[(R)-methylsulfinyl]phenyl]urea |
|---|---|
| PubChem CID | 97054229 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-[3-[(R)-methylsulfinyl]phenyl]urea |
| SMILES | CCc1nc2n(n1)CCC[C@@H]2NC(=O)Nc1cccc([S@@](C)=O)c1 |
| InChI | InChI=1S/C16H21N5O2S/c1-3-14-19-15-13(8-5-9-21(15)20-14)18-16(22)17-11-6-4-7-12(10-11)24(2)23/h4,6-7,10,13H,3,5,8-9H2,1-2H3,(H2,17,18,22)/t13-,24+/m0/s1 |
| InChIKey | NWDUJIDUWOCQSZ-RKNYENMMSA-N |
| XLogP | 2.23 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |