C18H22N6O — CID 96537541
1-[(1R)-1-(3-cyanophenyl)ethyl]-3-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea (PubChem CID 96537541) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 1-[(1R)-1-(3-cyanophenyl)ethyl]-3-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea.
| Compound Name | 1-[(1R)-1-(3-cyanophenyl)ethyl]-3-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea |
|---|---|
| PubChem CID | 96537541 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 1-[(1R)-1-(3-cyanophenyl)ethyl]-3-[(8S)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea |
| SMILES | CCc1nc2n(n1)CCC[C@@H]2NC(=O)N[C@H](C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C18H22N6O/c1-3-16-22-17-15(8-5-9-24(17)23-16)21-18(25)20-12(2)14-7-4-6-13(10-14)11-19/h4,6-7,10,12,15H,3,5,8-9H2,1-2H3,(H2,20,21,25)/t12-,15+/m1/s1 |
| InChIKey | RSWJXTATLMTOMR-DOMZBBRYSA-N |
| XLogP | 2.61 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |