C17H31Cl2N5O — CID 119900263
N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-piperidin-4-ylbutanamide;dihydrochloride (PubChem CID 119900263) has the molecular formula C17H31Cl2N5O and a molecular weight of 392.38 g/mol. Its IUPAC name is N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-piperidin-4-ylbutanamide;dihydrochloride.
| Compound Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-piperidin-4-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119900263 |
| Molecular Formula | C17H31Cl2N5O |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-piperidin-4-ylbutanamide;dihydrochloride |
| SMILES | CCc1nc2n(n1)CCCC2NC(=O)CC(C)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C17H29N5O.2ClH/c1-3-15-20-17-14(5-4-10-22(17)21-15)19-16(23)11-12(2)13-6-8-18-9-7-13;;/h12-14,18H,3-11H2,1-2H3,(H,19,23);2*1H |
| InChIKey | OGBXWBOLWPTKTF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |