C17H25Cl2N5O — CID 119954217
3-amino-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-phenylpropanamide;dihydrochloride (PubChem CID 119954217) has the molecular formula C17H25Cl2N5O and a molecular weight of 386.33 g/mol. Its IUPAC name is 3-amino-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-phenylpropanamide;dihydrochloride.
| Compound Name | 3-amino-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-phenylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119954217 |
| Molecular Formula | C17H25Cl2N5O |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-amino-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-phenylpropanamide;dihydrochloride |
| SMILES | CCc1nc2n(n1)CCCC2NC(=O)CC(N)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C17H23N5O.2ClH/c1-2-15-20-17-14(9-6-10-22(17)21-15)19-16(23)11-13(18)12-7-4-3-5-8-12;;/h3-5,7-8,13-14H,2,6,9-11,18H2,1H3,(H,19,23);2*1H |
| InChIKey | OWHNCTCTILUZNT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |