C12H15F2N7OS — CID 97054164
1-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-3-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea (PubChem CID 97054164) has the molecular formula C12H15F2N7OS and a molecular weight of 343.36 g/mol. Its IUPAC name is 1-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-3-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea.
| Compound Name | 1-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-3-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea |
|---|---|
| PubChem CID | 97054164 |
| Molecular Formula | C12H15F2N7OS |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 1-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-3-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]urea |
| SMILES | CCc1nc2n(n1)CCC[C@H]2NC(=O)Nc1nnc(C(F)F)s1 |
| InChI | InChI=1S/C12H15F2N7OS/c1-2-7-16-9-6(4-3-5-21(9)20-7)15-11(22)17-12-19-18-10(23-12)8(13)14/h6,8H,2-5H2,1H3,(H2,15,17,19,22)/t6-/m1/s1 |
| InChIKey | UTJVKGXNFWXCHZ-ZCFIWIBFSA-N |
| XLogP | 2.29 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |