C16H23Cl2N5O — CID 119900239
2-(4-aminophenyl)-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)acetamide;dihydrochloride (PubChem CID 119900239) has the molecular formula C16H23Cl2N5O and a molecular weight of 372.30 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119900239 |
| Molecular Formula | C16H23Cl2N5O |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-(4-aminophenyl)-N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)acetamide;dihydrochloride |
| SMILES | CCc1nc2n(n1)CCCC2NC(=O)Cc1ccc(N)cc1.Cl.Cl |
| InChI | InChI=1S/C16H21N5O.2ClH/c1-2-14-19-16-13(4-3-9-21(16)20-14)18-15(22)10-11-5-7-12(17)8-6-11;;/h5-8,13H,2-4,9-10,17H2,1H3,(H,18,22);2*1H |
| InChIKey | OONDSURILGESNH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|