C17H23N5O — CID 97102372
N-[3-[(1S)-1-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]ethyl]phenyl]acetamide (PubChem CID 97102372) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is N-[3-[(1S)-1-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]ethyl]phenyl]acetamide.
| Compound Name | N-[3-[(1S)-1-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 97102372 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-[3-[(1S)-1-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc([C@H](C)N[C@@H]2CCCn3nc(C)nc32)c1 |
| InChI | InChI=1S/C17H23N5O/c1-11(14-6-4-7-15(10-14)20-13(3)23)18-16-8-5-9-22-17(16)19-12(2)21-22/h4,6-7,10-11,16,18H,5,8-9H2,1-3H3,(H,20,23)/t11-,16+/m0/s1 |
| InChIKey | KNDXMHVCQRMSDX-MEDUHNTESA-N |
| XLogP | 2.73 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |