C17H23N5OS — CID 71923246
1-[3-(ethylsulfanylmethyl)phenyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea (PubChem CID 71923246) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[3-(ethylsulfanylmethyl)phenyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea.
| Compound Name | 1-[3-(ethylsulfanylmethyl)phenyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
|---|---|
| PubChem CID | 71923246 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-[3-(ethylsulfanylmethyl)phenyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
| SMILES | CCSCc1cccc(NC(=O)NC2CCCn3nc(C)nc32)c1 |
| InChI | InChI=1S/C17H23N5OS/c1-3-24-11-13-6-4-7-14(10-13)19-17(23)20-15-8-5-9-22-16(15)18-12(2)21-22/h4,6-7,10,15H,3,5,8-9,11H2,1-2H3,(H2,19,20,23) |
| InChIKey | OGWQBIZHEDZUEQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |