C16H22N2O2 — CID 79832263
1-(3-acetylphenyl)-3-(2,2-dimethylcyclopentyl)urea (PubChem CID 79832263) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-(2,2-dimethylcyclopentyl)urea.
| Compound Name | 1-(3-acetylphenyl)-3-(2,2-dimethylcyclopentyl)urea |
|---|---|
| PubChem CID | 79832263 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(3-acetylphenyl)-3-(2,2-dimethylcyclopentyl)urea |
| SMILES | CC(=O)c1cccc(NC(=O)NC2CCCC2(C)C)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-11(19)12-6-4-7-13(10-12)17-15(20)18-14-8-5-9-16(14,2)3/h4,6-7,10,14H,5,8-9H2,1-3H3,(H2,17,18,20) |
| InChIKey | PKKULQGJSKTBNT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |