C15H19NO3 — CID 79872488
3-[(2,2-dimethylcyclopentyl)carbamoyl]benzoic acid (PubChem CID 79872488) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-[(2,2-dimethylcyclopentyl)carbamoyl]benzoic acid.
| Compound Name | 3-[(2,2-dimethylcyclopentyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 79872488 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 3-[(2,2-dimethylcyclopentyl)carbamoyl]benzoic acid |
| SMILES | CC1(C)CCCC1NC(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H19NO3/c1-15(2)8-4-7-12(15)16-13(17)10-5-3-6-11(9-10)14(18)19/h3,5-6,9,12H,4,7-8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | MBRJVYHGZAOJGO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |