C17H21NO3 — CID 79870096
3-[4-[(2,2-dimethylcyclopentyl)carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 79870096) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-[4-[(2,2-dimethylcyclopentyl)carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(2,2-dimethylcyclopentyl)carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79870096 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-[4-[(2,2-dimethylcyclopentyl)carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | CC1(C)CCCC1NC(=O)c1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C17H21NO3/c1-17(2)11-3-4-14(17)18-16(21)13-8-5-12(6-9-13)7-10-15(19)20/h5-10,14H,3-4,11H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | WAZDGMRPBJWXBK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|