About 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide
3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide (PubChem CID 79855552) has the molecular formula C15H23N3O
and a molecular weight of 261.37 g/mol. Its IUPAC name is 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide.
Molecular Properties
| Compound Name | 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide |
| PubChem CID | 79855552 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide |
| SMILES | CC1(C)CCCCC1NC(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C15H23N3O/c1-15(2)6-4-3-5-13(15)18-14(19)10-7-11(16)9-12(17)8-10/h7-9,13H,3-6,16-17H2,1-2H3,(H,18,19) |
| InChIKey | XOYBRQIXQAFXHE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide?
The IUPAC name of 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide (CID 79855552) is 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide.
What is the SMILES notation for 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide?
The canonical SMILES for 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide is CC1(C)CCCCC1NC(=O)c1cc(N)cc(N)c1.
What is the InChIKey of 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide?
The InChIKey is XOYBRQIXQAFXHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O/c1-15(2)6-4-3-5-13(15)18-14(19)10-7-11(16)9-12(17)8-10/h7-9,13H,3-6,16-17H2,1-2H3,(H,18,19).
What are the key properties of 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide?
3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide has a molecular weight of 261.37 g/mol, XLogP of 2.55, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-N-(2,2-dimethylcyclohexyl)benzamide is sourced from PubChem (CID 79855552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).