About 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide
5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide (PubChem CID 107185521) has the molecular formula C15H20Cl2N2O
and a molecular weight of 315.24 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide.
Molecular Properties
| Compound Name | 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide |
| PubChem CID | 107185521 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide |
| SMILES | CC1(C)CCCCC1NC(=O)c1cc(N)cc(Cl)c1Cl |
| InChI | InChI=1S/C15H20Cl2N2O/c1-15(2)6-4-3-5-12(15)19-14(20)10-7-9(18)8-11(16)13(10)17/h7-8,12H,3-6,18H2,1-2H3,(H,19,20) |
| InChIKey | PKFGWSXNINDTNI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide?
The IUPAC name of 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide (CID 107185521) is 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide.
What is the SMILES notation for 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide?
The canonical SMILES for 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide is CC1(C)CCCCC1NC(=O)c1cc(N)cc(Cl)c1Cl.
What is the InChIKey of 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide?
The InChIKey is PKFGWSXNINDTNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Cl2N2O/c1-15(2)6-4-3-5-12(15)19-14(20)10-7-9(18)8-11(16)13(10)17/h7-8,12H,3-6,18H2,1-2H3,(H,19,20).
What are the key properties of 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide?
5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide has a molecular weight of 315.24 g/mol, XLogP of 4.27, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,3-dichloro-N-(2,2-dimethylcyclohexyl)benzamide is sourced from PubChem (CID 107185521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).