C14H18Cl2N2O2 — CID 107185637
5-amino-2,3-dichloro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzamide (PubChem CID 107185637) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzamide |
|---|---|
| PubChem CID | 107185637 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 5-amino-2,3-dichloro-N-[[1-(hydroxymethyl)cyclopentyl]methyl]benzamide |
| SMILES | Nc1cc(Cl)c(Cl)c(C(=O)NCC2(CO)CCCC2)c1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c15-11-6-9(17)5-10(12(11)16)13(20)18-7-14(8-19)3-1-2-4-14/h5-6,19H,1-4,7-8,17H2,(H,18,20) |
| InChIKey | BKZYGMQUXCBMGW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|