C13H16Cl2N2O — CID 114098995
5-amino-2,3-dichloro-N-[(1-ethylcyclopropyl)methyl]benzamide (PubChem CID 114098995) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is 5-amino-2,3-dichloro-N-[(1-ethylcyclopropyl)methyl]benzamide.
| Compound Name | 5-amino-2,3-dichloro-N-[(1-ethylcyclopropyl)methyl]benzamide |
|---|---|
| PubChem CID | 114098995 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 5-amino-2,3-dichloro-N-[(1-ethylcyclopropyl)methyl]benzamide |
| SMILES | CCC1(CNC(=O)c2cc(N)cc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C13H16Cl2N2O/c1-2-13(3-4-13)7-17-12(18)9-5-8(16)6-10(14)11(9)15/h5-6H,2-4,7,16H2,1H3,(H,17,18) |
| InChIKey | BPWYCXNMBMKZPJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|