C14H20ClN3O — CID 79873055
6-amino-3-chloro-N-(2,2-dimethylcyclohexyl)pyridine-2-carboxamide (PubChem CID 79873055) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is 6-amino-3-chloro-N-(2,2-dimethylcyclohexyl)pyridine-2-carboxamide.
| Compound Name | 6-amino-3-chloro-N-(2,2-dimethylcyclohexyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 79873055 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 6-amino-3-chloro-N-(2,2-dimethylcyclohexyl)pyridine-2-carboxamide |
| SMILES | CC1(C)CCCCC1NC(=O)c1nc(N)ccc1Cl |
| InChI | InChI=1S/C14H20ClN3O/c1-14(2)8-4-3-5-10(14)17-13(19)12-9(15)6-7-11(16)18-12/h6-7,10H,3-5,8H2,1-2H3,(H2,16,18)(H,17,19) |
| InChIKey | XVKQXGCVKXMQFJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |