C10H12ClN3OS — CID 103064660
6-amino-3-chloro-N-(thiolan-3-yl)pyridine-2-carboxamide (PubChem CID 103064660) has the molecular formula C10H12ClN3OS and a molecular weight of 257.75 g/mol. Its IUPAC name is 6-amino-3-chloro-N-(thiolan-3-yl)pyridine-2-carboxamide.
| Compound Name | 6-amino-3-chloro-N-(thiolan-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103064660 |
| Molecular Formula | C10H12ClN3OS |
| Molecular Weight | 257.75 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 6-amino-3-chloro-N-(thiolan-3-yl)pyridine-2-carboxamide |
| SMILES | Nc1ccc(Cl)c(C(=O)NC2CCSC2)n1 |
| InChI | InChI=1S/C10H12ClN3OS/c11-7-1-2-8(12)14-9(7)10(15)13-6-3-4-16-5-6/h1-2,6H,3-5H2,(H2,12,14)(H,13,15) |
| InChIKey | OYHDNRZMOMRPEF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.75 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |