C12H13N3OS2 — CID 103063030
2-amino-N-(thiolan-3-yl)-1,3-benzothiazole-6-carboxamide (PubChem CID 103063030) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-amino-N-(thiolan-3-yl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-(thiolan-3-yl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 103063030 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-amino-N-(thiolan-3-yl)-1,3-benzothiazole-6-carboxamide |
| SMILES | Nc1nc2ccc(C(=O)NC3CCSC3)cc2s1 |
| InChI | InChI=1S/C12H13N3OS2/c13-12-15-9-2-1-7(5-10(9)18-12)11(16)14-8-3-4-17-6-8/h1-2,5,8H,3-4,6H2,(H2,13,15)(H,14,16) |
| InChIKey | HDAONMQLUGQWLV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |