C12H9N5OS — CID 60719150
2-amino-N-pyrimidin-2-yl-1,3-benzothiazole-6-carboxamide (PubChem CID 60719150) has the molecular formula C12H9N5OS and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-amino-N-pyrimidin-2-yl-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-pyrimidin-2-yl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 60719150 |
| Molecular Formula | C12H9N5OS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-amino-N-pyrimidin-2-yl-1,3-benzothiazole-6-carboxamide |
| SMILES | Nc1nc2ccc(C(=O)Nc3ncccn3)cc2s1 |
| InChI | InChI=1S/C12H9N5OS/c13-11-16-8-3-2-7(6-9(8)19-11)10(18)17-12-14-4-1-5-15-12/h1-6H,(H2,13,16)(H,14,15,17,18) |
| InChIKey | KTHYSWHEZRXSFF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |