C13H9FN4OS — CID 116813293
2-amino-N-(6-fluoro-2-pyridinyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 116813293) has the molecular formula C13H9FN4OS and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-amino-N-(6-fluoro-2-pyridinyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-amino-N-(6-fluoro-2-pyridinyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 116813293 |
| Molecular Formula | C13H9FN4OS |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-amino-N-(6-fluoro-2-pyridinyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | Nc1nc2ccc(C(=O)Nc3cccc(F)n3)cc2s1 |
| InChI | InChI=1S/C13H9FN4OS/c14-10-2-1-3-11(17-10)18-12(19)7-4-5-8-9(6-7)20-13(15)16-8/h1-6H,(H2,15,16)(H,17,18,19) |
| InChIKey | KVJRGCICVWXWCE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|