C11H12FNOS — CID 126773687
3-fluoro-N-(thiolan-3-yl)benzamide (PubChem CID 126773687) has the molecular formula C11H12FNOS and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-fluoro-N-(thiolan-3-yl)benzamide.
| Compound Name | 3-fluoro-N-(thiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 126773687 |
| Molecular Formula | C11H12FNOS |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 3-fluoro-N-(thiolan-3-yl)benzamide |
| SMILES | O=C(NC1CCSC1)c1cccc(F)c1 |
| InChI | InChI=1S/C11H12FNOS/c12-9-3-1-2-8(6-9)11(14)13-10-4-5-15-7-10/h1-3,6,10H,4-5,7H2,(H,13,14) |
| InChIKey | XUKVWHVDLBOHKR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |