C11H13NO3S — CID 103063299
2,3-dihydroxy-N-(thiolan-3-yl)benzamide (PubChem CID 103063299) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(thiolan-3-yl)benzamide.
| Compound Name | 2,3-dihydroxy-N-(thiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 103063299 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2,3-dihydroxy-N-(thiolan-3-yl)benzamide |
| SMILES | O=C(NC1CCSC1)c1cccc(O)c1O |
| InChI | InChI=1S/C11H13NO3S/c13-9-3-1-2-8(10(9)14)11(15)12-7-4-5-16-6-7/h1-3,7,13-14H,4-6H2,(H,12,15) |
| InChIKey | JLULPOGAJATHLI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|