C11H12INO2S — CID 103711939
2-hydroxy-5-iodo-N-(thiolan-3-yl)benzamide (PubChem CID 103711939) has the molecular formula C11H12INO2S and a molecular weight of 349.19 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-(thiolan-3-yl)benzamide.
| Compound Name | 2-hydroxy-5-iodo-N-(thiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 103711939 |
| Molecular Formula | C11H12INO2S |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | 2-hydroxy-5-iodo-N-(thiolan-3-yl)benzamide |
| SMILES | O=C(NC1CCSC1)c1cc(I)ccc1O |
| InChI | InChI=1S/C11H12INO2S/c12-7-1-2-10(14)9(5-7)11(15)13-8-3-4-16-6-8/h1-2,5,8,14H,3-4,6H2,(H,13,15) |
| InChIKey | XKIVNUXFZRUURW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|