C14H16INO4 — CID 107731367
2-[(2-hydroxy-5-iodobenzoyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 107731367) has the molecular formula C14H16INO4 and a molecular weight of 389.19 g/mol. Its IUPAC name is 2-[(2-hydroxy-5-iodobenzoyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[(2-hydroxy-5-iodobenzoyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 107731367 |
| Molecular Formula | C14H16INO4 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-[(2-hydroxy-5-iodobenzoyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1CCCCC1C(=O)O)c1cc(I)ccc1O |
| InChI | InChI=1S/C14H16INO4/c15-8-5-6-12(17)10(7-8)13(18)16-11-4-2-1-3-9(11)14(19)20/h5-7,9,11,17H,1-4H2,(H,16,18)(H,19,20) |
| InChIKey | KIVKARPVCMYLTM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|