C15H18INO4 — CID 107731451
2-[(2-hydroxy-5-iodobenzoyl)amino]-1-methylcyclohexane-1-carboxylic acid (PubChem CID 107731451) has the molecular formula C15H18INO4 and a molecular weight of 403.22 g/mol. Its IUPAC name is 2-[(2-hydroxy-5-iodobenzoyl)amino]-1-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[(2-hydroxy-5-iodobenzoyl)amino]-1-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 107731451 |
| Molecular Formula | C15H18INO4 |
| Molecular Weight | 403.22 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 2-[(2-hydroxy-5-iodobenzoyl)amino]-1-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCCC1NC(=O)c1cc(I)ccc1O |
| InChI | InChI=1S/C15H18INO4/c1-15(14(20)21)7-3-2-4-12(15)17-13(19)10-8-9(16)5-6-11(10)18/h5-6,8,12,18H,2-4,7H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | PBLXJYLXKDZNNF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|