C11H11IN2O3 — CID 103526859
2-hydroxy-5-iodo-N-(5-oxopyrrolidin-3-yl)benzamide (PubChem CID 103526859) has the molecular formula C11H11IN2O3 and a molecular weight of 346.12 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-(5-oxopyrrolidin-3-yl)benzamide.
| Compound Name | 2-hydroxy-5-iodo-N-(5-oxopyrrolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 103526859 |
| Molecular Formula | C11H11IN2O3 |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 2-hydroxy-5-iodo-N-(5-oxopyrrolidin-3-yl)benzamide |
| SMILES | O=C1CC(NC(=O)c2cc(I)ccc2O)CN1 |
| InChI | InChI=1S/C11H11IN2O3/c12-6-1-2-9(15)8(3-6)11(17)14-7-4-10(16)13-5-7/h1-3,7,15H,4-5H2,(H,13,16)(H,14,17) |
| InChIKey | DFPYADRCXXKJJH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|