C10H13N5O2 — CID 106197858
4-hydrazinyl-N-(5-oxopyrrolidin-3-yl)pyridine-3-carboxamide (PubChem CID 106197858) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 4-hydrazinyl-N-(5-oxopyrrolidin-3-yl)pyridine-3-carboxamide.
| Compound Name | 4-hydrazinyl-N-(5-oxopyrrolidin-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106197858 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 4-hydrazinyl-N-(5-oxopyrrolidin-3-yl)pyridine-3-carboxamide |
| SMILES | NNc1ccncc1C(=O)NC1CNC(=O)C1 |
| InChI | InChI=1S/C10H13N5O2/c11-15-8-1-2-12-5-7(8)10(17)14-6-3-9(16)13-4-6/h1-2,5-6H,3-4,11H2,(H,12,15)(H,13,16)(H,14,17) |
| InChIKey | RQCLYRSSAGGQEG-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|