C12H14INO3 — CID 104600964
2-hydroxy-5-iodo-N-(3-methoxycyclobutyl)benzamide (PubChem CID 104600964) has the molecular formula C12H14INO3 and a molecular weight of 347.15 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-(3-methoxycyclobutyl)benzamide.
| Compound Name | 2-hydroxy-5-iodo-N-(3-methoxycyclobutyl)benzamide |
|---|---|
| PubChem CID | 104600964 |
| Molecular Formula | C12H14INO3 |
| Molecular Weight | 347.15 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 2-hydroxy-5-iodo-N-(3-methoxycyclobutyl)benzamide |
| SMILES | COC1CC(NC(=O)c2cc(I)ccc2O)C1 |
| InChI | InChI=1S/C12H14INO3/c1-17-9-5-8(6-9)14-12(16)10-4-7(13)2-3-11(10)15/h2-4,8-9,15H,5-6H2,1H3,(H,14,16) |
| InChIKey | OZBULFAHJXWMQB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|